C8H16OS — CID 22212713
(2S,6R)-2-ethyl-2,6-dimethyl-1,3-oxathiane (PubChem CID 22212713) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (2S,6R)-2-ethyl-2,6-dimethyl-1,3-oxathiane.
| Compound Name | (2S,6R)-2-ethyl-2,6-dimethyl-1,3-oxathiane |
|---|---|
| PubChem CID | 22212713 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2S,6R)-2-ethyl-2,6-dimethyl-1,3-oxathiane |
| SMILES | CC[C@@]1(C)O[C@H](C)CCS1 |
| InChI | InChI=1S/C8H16OS/c1-4-8(3)9-7(2)5-6-10-8/h7H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | YVLBDUNYLRKAHD-SFYZADRCSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |