C24H31NO6S — CID 22212778
[2-[(8S,9R,10S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-9-thiocyanato-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 22212778) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-9-thiocyanato-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-9-thiocyanato-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 22212778 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-9-thiocyanato-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(SC#N)C(O)C[C@@]21C |
| InChI | InChI=1S/C24H31NO6S/c1-14(26)31-12-20(29)23(30)9-7-17-18-5-4-15-10-16(27)6-8-21(15,2)24(18,32-13-25)19(28)11-22(17,23)3/h10,17-19,28,30H,4-9,11-12H2,1-3H3/t17-,18-,19?,21-,22-,23-,24-/m0/s1 |
| InChIKey | MIRIANPOCDFQHN-JIXOJECMSA-N |
| XLogP | 2.69 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|