About [(1S,2S)-2-methylcyclopentyl] acetate
[(1S,2S)-2-methylcyclopentyl] acetate (PubChem CID 22212873) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclopentyl] acetate.
Molecular Properties
| Compound Name | [(1S,2S)-2-methylcyclopentyl] acetate |
| PubChem CID | 22212873 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | [(1S,2S)-2-methylcyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@@H]1C |
| InChI | InChI=1S/C8H14O2/c1-6-4-3-5-8(6)10-7(2)9/h6,8H,3-5H2,1-2H3/t6-,8-/m0/s1 |
| InChIKey | LYFLFZRUQLBWKF-XPUUQOCRSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-2-methylcyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-methylcyclopentyl] acetate?
The IUPAC name of [(1S,2S)-2-methylcyclopentyl] acetate (CID 22212873) is [(1S,2S)-2-methylcyclopentyl] acetate.
What is the SMILES notation for [(1S,2S)-2-methylcyclopentyl] acetate?
The canonical SMILES for [(1S,2S)-2-methylcyclopentyl] acetate is CC(=O)O[C@H]1CCC[C@@H]1C.
What is the InChIKey of [(1S,2S)-2-methylcyclopentyl] acetate?
The InChIKey is LYFLFZRUQLBWKF-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H14O2/c1-6-4-3-5-8(6)10-7(2)9/h6,8H,3-5H2,1-2H3/t6-,8-/m0/s1.
What are the key properties of [(1S,2S)-2-methylcyclopentyl] acetate?
[(1S,2S)-2-methylcyclopentyl] acetate has a molecular weight of 142.20 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-methylcyclopentyl] acetate is sourced from PubChem (CID 22212873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).