C16H25NO9 — CID 22212982
[(2R,3S,4R,5R,6S)-5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 22212982) has the molecular formula C16H25NO9 and a molecular weight of 375.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22212982 |
| Molecular Formula | C16H25NO9 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1N(C)C(C)=O |
| InChI | InChI=1S/C16H25NO9/c1-8(18)17(5)13-15(25-11(4)21)14(24-10(3)20)12(7-23-9(2)19)26-16(13)22-6/h12-16H,7H2,1-6H3/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | YHVKYAZUIGOUHQ-QCODTGAPSA-N |
| XLogP | -0.37 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|