About methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate
methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 22213049) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 22213049 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C[C@H](OC(C)=O)[C@H]1OC |
| InChI | InChI=1S/C11H14O5/c1-7(12)16-9-6-4-5-8(10(9)14-2)11(13)15-3/h4-6,9-10H,1-3H3/t9-,10-/m0/s1 |
| InChIKey | JIQYYDGGCIGGRU-UWVGGRQHSA-N |
| XLogP | 0.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate (CID 22213049) is methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=C[C@H](OC(C)=O)[C@H]1OC.
What is the InChIKey of methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate?
The InChIKey is JIQYYDGGCIGGRU-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H14O5/c1-7(12)16-9-6-4-5-8(10(9)14-2)11(13)15-3/h4-6,9-10H,1-3H3/t9-,10-/m0/s1.
What are the key properties of methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate?
methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate has a molecular weight of 226.23 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5S,6S)-5-acetyloxy-6-methoxycyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 22213049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).