C18H23NO9 — CID 22213098
methyl 2-methyl-5-[(2R,3S,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]-1H-pyrrole-3-carboxylate (PubChem CID 22213098) has the molecular formula C18H23NO9 and a molecular weight of 397.38 g/mol. Its IUPAC name is methyl 2-methyl-5-[(2R,3S,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(2R,3S,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 22213098 |
| Molecular Formula | C18H23NO9 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 2-methyl-5-[(2R,3S,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc([C@H]2OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[nH]c1C |
| InChI | InChI=1S/C18H23NO9/c1-8-12(18(23)24-5)6-13(19-8)15-17(28-11(4)22)16(27-10(3)21)14(7-25-15)26-9(2)20/h6,14-17,19H,7H2,1-5H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | IVXMGDBOYFLJLV-VQHPVUNQSA-N |
| XLogP | 0.98 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|