About cis-(2R,3S)-2,3-dimethylcyclobutan-1-one
cis-(2R,3S)-2,3-dimethylcyclobutan-1-one (PubChem CID 22213570) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is cis-(2R,3S)-2,3-dimethylcyclobutan-1-one.
Molecular Properties
| Compound Name | cis-(2R,3S)-2,3-dimethylcyclobutan-1-one |
| PubChem CID | 22213570 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | cis-(2R,3S)-2,3-dimethylcyclobutan-1-one |
| SMILES | C[C@H]1CC(=O)[C@@H]1C |
| InChI | InChI=1S/C6H10O/c1-4-3-6(7)5(4)2/h4-5H,3H2,1-2H3/t4-,5+/m0/s1 |
| InChIKey | GLVGZXHESDAIMP-CRCLSJGQSA-N |
| XLogP | 1.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(2R,3S)-2,3-dimethylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3S)-2,3-dimethylcyclobutan-1-one?
The IUPAC name of cis-(2R,3S)-2,3-dimethylcyclobutan-1-one (CID 22213570) is cis-(2R,3S)-2,3-dimethylcyclobutan-1-one.
What is the SMILES notation for cis-(2R,3S)-2,3-dimethylcyclobutan-1-one?
The canonical SMILES for cis-(2R,3S)-2,3-dimethylcyclobutan-1-one is C[C@H]1CC(=O)[C@@H]1C.
What is the InChIKey of cis-(2R,3S)-2,3-dimethylcyclobutan-1-one?
The InChIKey is GLVGZXHESDAIMP-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H10O/c1-4-3-6(7)5(4)2/h4-5H,3H2,1-2H3/t4-,5+/m0/s1.
What are the key properties of cis-(2R,3S)-2,3-dimethylcyclobutan-1-one?
cis-(2R,3S)-2,3-dimethylcyclobutan-1-one has a molecular weight of 98.14 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3S)-2,3-dimethylcyclobutan-1-one is sourced from PubChem (CID 22213570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).