C15H28O4S — CID 22213636
S-tert-butyl (2R,4R)-2-tert-butyl-4-(2-hydroxypropan-2-yl)-1,3-dioxolane-4-carbothioate (PubChem CID 22213636) has the molecular formula C15H28O4S and a molecular weight of 304.45 g/mol. Its IUPAC name is S-tert-butyl (2R,4R)-2-tert-butyl-4-(2-hydroxypropan-2-yl)-1,3-dioxolane-4-carbothioate.
| Compound Name | S-tert-butyl (2R,4R)-2-tert-butyl-4-(2-hydroxypropan-2-yl)-1,3-dioxolane-4-carbothioate |
|---|---|
| PubChem CID | 22213636 |
| Molecular Formula | C15H28O4S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | S-tert-butyl (2R,4R)-2-tert-butyl-4-(2-hydroxypropan-2-yl)-1,3-dioxolane-4-carbothioate |
| SMILES | CC(C)(C)SC(=O)[C@]1(C(C)(C)O)CO[C@@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C15H28O4S/c1-12(2,3)11-18-9-15(19-11,14(7,8)17)10(16)20-13(4,5)6/h11,17H,9H2,1-8H3/t11-,15+/m1/s1 |
| InChIKey | KOANWSTYQUSPBG-ABAIWWIYSA-N |
| XLogP | 2.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|