About trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one
trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one (PubChem CID 22213714) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one |
| PubChem CID | 22213714 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one |
| SMILES | CO[C@H]1CC(=O)C[C@H](OC)C1 |
| InChI | InChI=1S/C8H14O3/c1-10-7-3-6(9)4-8(5-7)11-2/h7-8H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | PMQLPPDWMOUCAJ-YUMQZZPRSA-N |
| XLogP | 0.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one?
The IUPAC name of trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one (CID 22213714) is trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one.
What is the SMILES notation for trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one?
The canonical SMILES for trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one is CO[C@H]1CC(=O)C[C@H](OC)C1.
What is the InChIKey of trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one?
The InChIKey is PMQLPPDWMOUCAJ-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H14O3/c1-10-7-3-6(9)4-8(5-7)11-2/h7-8H,3-5H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one?
trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one has a molecular weight of 158.20 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,5R)-3,5-dimethoxycyclohexan-1-one is sourced from PubChem (CID 22213714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).