About 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde
2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde (PubChem CID 22213848) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde |
| PubChem CID | 22213848 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde |
| SMILES | CC1OC=CCC1C=O |
| InChI | InChI=1S/C7H10O2/c1-6-7(5-8)3-2-4-9-6/h2,4-7H,3H2,1H3 |
| InChIKey | DGEGXQWXTLOQAT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde?
The IUPAC name of 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde (CID 22213848) is 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde is CC1OC=CCC1C=O.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde?
The InChIKey is DGEGXQWXTLOQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-6-7(5-8)3-2-4-9-6/h2,4-7H,3H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde?
2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde has a molecular weight of 126.15 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-pyran-3-carbaldehyde is sourced from PubChem (CID 22213848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).