C8H12O3 — CID 22214041
(4aR,8aR)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one (PubChem CID 22214041) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (4aR,8aR)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one.
| Compound Name | (4aR,8aR)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 22214041 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (4aR,8aR)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
| SMILES | O=C1CC[C@H]2OCCC[C@H]2O1 |
| InChI | InChI=1S/C8H12O3/c9-8-4-3-6-7(11-8)2-1-5-10-6/h6-7H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | BPYDYQQKJTYIAB-RNFRBKRXSA-N |
| XLogP | 0.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |