C18H40O7Si4 — CID 22214264
2-hydroxy-1,1,3,3-tetrakis(trimethylsilyl)propane-1,2,3-tricarboxylic acid (PubChem CID 22214264) has the molecular formula C18H40O7Si4 and a molecular weight of 480.86 g/mol. Its IUPAC name is 2-hydroxy-1,1,3,3-tetrakis(trimethylsilyl)propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-1,1,3,3-tetrakis(trimethylsilyl)propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 22214264 |
| Molecular Formula | C18H40O7Si4 |
| Molecular Weight | 480.86 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-hydroxy-1,1,3,3-tetrakis(trimethylsilyl)propane-1,2,3-tricarboxylic acid |
| SMILES | C[Si](C)(C)C(C(=O)O)(C(O)(C(=O)O)C(C(=O)O)([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H40O7Si4/c1-26(2,3)17(14(21)22,27(4,5)6)16(25,13(19)20)18(15(23)24,28(7,8)9)29(10,11)12/h25H,1-12H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | UTVKVESZBOPBBC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|