C25H44O2Si2 — CID 22214269
[(5S,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-11-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 22214269) has the molecular formula C25H44O2Si2 and a molecular weight of 432.80 g/mol. Its IUPAC name is [(5S,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-11-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(5S,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-11-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 22214269 |
| Molecular Formula | C25H44O2Si2 |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(5S,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-11-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | C[C@]12CC=CC[C@@H]1CC[C@@H]1[C@@H]2[C@@H](O[Si](C)(C)C)C[C@]2(C)C(O[Si](C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H44O2Si2/c1-24-16-10-9-11-18(24)12-13-19-20-14-15-22(27-29(6,7)8)25(20,2)17-21(23(19)24)26-28(3,4)5/h9-10,15,18-21,23H,11-14,16-17H2,1-8H3/t18-,19+,20+,21+,23-,24+,25+/m1/s1 |
| InChIKey | CQKWROIPXFAXPJ-YDLWURSQSA-N |
| XLogP | 7.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|