C24H60O11PSi6- — CID 22214343
bis(trimethylsilyl) phosphate;trimethylsilyl (2S,3R,4S,5R)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 22214343) has the molecular formula C24H60O11PSi6- and a molecular weight of 724.22 g/mol. Its IUPAC name is bis(trimethylsilyl) phosphate;trimethylsilyl (2S,3R,4S,5R)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | bis(trimethylsilyl) phosphate;trimethylsilyl (2S,3R,4S,5R)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 22214343 |
| Molecular Formula | C24H60O11PSi6- |
| Molecular Weight | 724.22 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | bis(trimethylsilyl) phosphate;trimethylsilyl (2S,3R,4S,5R)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C.C[Si](C)(C)OP(=O)([O-])O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O7Si4.C6H19O4PSi2/c1-26(2,3)22-13-14(23-27(4,5)6)16(24-28(7,8)9)17(19)21-15(13)18(20)25-29(10,11)12;1-12(2,3)9-11(7,8)10-13(4,5)6/h13-17,19H,1-12H3;1-6H3,(H,7,8)/p-1/t13-,14-,15-,16+,17?;/m0./s1 |
| InChIKey | RERYMKJHFLSZNI-YMGOVGESSA-M |
| XLogP | 5.90 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.22 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|