C15H24O3 — CID 22214782
(1S,5S,7aS)-7a-methyl-1-(oxan-2-yloxy)-1,2,3,5,6,7-hexahydroinden-5-ol (PubChem CID 22214782) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,5S,7aS)-7a-methyl-1-(oxan-2-yloxy)-1,2,3,5,6,7-hexahydroinden-5-ol.
| Compound Name | (1S,5S,7aS)-7a-methyl-1-(oxan-2-yloxy)-1,2,3,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 22214782 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,5S,7aS)-7a-methyl-1-(oxan-2-yloxy)-1,2,3,5,6,7-hexahydroinden-5-ol |
| SMILES | C[C@]12CC[C@H](O)C=C1CC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C15H24O3/c1-15-8-7-12(16)10-11(15)5-6-13(15)18-14-4-2-3-9-17-14/h10,12-14,16H,2-9H2,1H3/t12-,13-,14?,15-/m0/s1 |
| InChIKey | ZRHPAEQIPBDNFD-NZATWWQASA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|