C18H34N2O4 — CID 22214822
butyl (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoate (PubChem CID 22214822) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is butyl (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoate.
| Compound Name | butyl (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 22214822 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | butyl (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoate |
| SMILES | CCCCOC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C18H34N2O4/c1-7-8-9-24-18(23)16(11-13(4)5)20-17(22)15(10-12(2)3)19-14(6)21/h12-13,15-16H,7-11H2,1-6H3,(H,19,21)(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | XXVNMZAXMRIAPY-HOTGVXAUSA-N |
| XLogP | 2.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|