C16H12Br6O2S — CID 22215090
1,2,4-tribromo-3,5-dimethyl-6-(2,3,5-tribromo-4,6-dimethylphenyl)sulfonylbenzene (PubChem CID 22215090) has the molecular formula C16H12Br6O2S and a molecular weight of 747.76 g/mol. Its IUPAC name is 1,2,4-tribromo-3,5-dimethyl-6-(2,3,5-tribromo-4,6-dimethylphenyl)sulfonylbenzene.
| Compound Name | 1,2,4-tribromo-3,5-dimethyl-6-(2,3,5-tribromo-4,6-dimethylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 22215090 |
| Molecular Formula | C16H12Br6O2S |
| Molecular Weight | 747.76 g/mol |
| Exact Mass | 741.57 |
| IUPAC Name | 1,2,4-tribromo-3,5-dimethyl-6-(2,3,5-tribromo-4,6-dimethylphenyl)sulfonylbenzene |
| SMILES | Cc1c(Br)c(C)c(S(=O)(=O)c2c(C)c(Br)c(C)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C16H12Br6O2S/c1-5-9(17)7(3)15(13(21)11(5)19)25(23,24)16-8(4)10(18)6(2)12(20)14(16)22/h1-4H3 |
| InChIKey | SORUQDVUNQJAOU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.76 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|