C30H46O2 — CID 22215821
(4aR,6aR,6aR,6bR,8aS,12R,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,4a,5,6,6a,7,9,10,12,12a,13,14,14a-tetradecahydropicene-3,8-dione (PubChem CID 22215821) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aS,12R,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,4a,5,6,6a,7,9,10,12,12a,13,14,14a-tetradecahydropicene-3,8-dione.
| Compound Name | (4aR,6aR,6aR,6bR,8aS,12R,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,4a,5,6,6a,7,9,10,12,12a,13,14,14a-tetradecahydropicene-3,8-dione |
|---|---|
| PubChem CID | 22215821 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aS,12R,12aS,14aR,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,4a,5,6,6a,7,9,10,12,12a,13,14,14a-tetradecahydropicene-3,8-dione |
| SMILES | C=C1CC[C@]2(C)C(=O)C[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@H]1C |
| InChI | InChI=1S/C30H46O2/c1-18-11-14-28(6)24(32)17-30(8)20(25(28)19(18)2)9-10-22-27(5)15-13-23(31)26(3,4)21(27)12-16-29(22,30)7/h19-22,25H,1,9-17H2,2-8H3/t19-,20+,21-,22+,25-,27-,28+,29+,30+/m0/s1 |
| InChIKey | AZJFPJVJBMGEOF-XZBOOGISSA-N |
| XLogP | 7.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|