propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate

C11H23NO2 — CID 22215989

IUPACpropan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate
SMILESCC(C)N[C@H](C(=O)OC(C)C)C(C)C
InChIInChI=1S/C11H23NO2/c1-7(2)10(12-8(3)4)11(13)14-9(5)6/h7-10,12H,1-6H3/t10-/m0/s1
InChIKeyPIWQFVRZDXIGQS-JTQLQIEISA-N
MW201.31 g/mol
LogP1.96
Rot. Bonds5

About propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate

propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate (PubChem CID 22215989) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate.

Molecular Properties

Compound Namepropan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate
PubChem CID22215989
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Namepropan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate
SMILESCC(C)N[C@H](C(=O)OC(C)C)C(C)C
InChIInChI=1S/C11H23NO2/c1-7(2)10(12-8(3)4)11(13)14-9(5)6/h7-10,12H,1-6H3/t10-/m0/s1
InChIKeyPIWQFVRZDXIGQS-JTQLQIEISA-N
XLogP1.96
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate?
The IUPAC name of propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate (CID 22215989) is propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate.
What is the SMILES notation for propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate?
The canonical SMILES for propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate is CC(C)N[C@H](C(=O)OC(C)C)C(C)C.
What is the InChIKey of propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate?
The InChIKey is PIWQFVRZDXIGQS-JTQLQIEISA-N. The full InChI is InChI=1S/C11H23NO2/c1-7(2)10(12-8(3)4)11(13)14-9(5)6/h7-10,12H,1-6H3/t10-/m0/s1.
What are the key properties of propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate?
propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate has a molecular weight of 201.31 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-3-methyl-2-(propan-2-ylamino)butanoate is sourced from PubChem (CID 22215989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).