C16H30 — CID 22216270
(1S,5S)-1-ethyl-3,5,8,8-tetramethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene (PubChem CID 22216270) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is (1S,5S)-1-ethyl-3,5,8,8-tetramethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene.
| Compound Name | (1S,5S)-1-ethyl-3,5,8,8-tetramethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 22216270 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | (1S,5S)-1-ethyl-3,5,8,8-tetramethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
| SMILES | CC[C@H]1CC(C)CC2C1C(C)(C)CC[C@@H]2C |
| InChI | InChI=1S/C16H30/c1-6-13-9-11(2)10-14-12(3)7-8-16(4,5)15(13)14/h11-15H,6-10H2,1-5H3/t11?,12-,13-,14?,15?/m0/s1 |
| InChIKey | LSESUEKKIDALDU-PYJARURNSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |