C25H34N2O5 — CID 22216732
1-[(1R,4R,12R,16S)-7,8,9-trimethoxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6,8,10-trien-5-yl]propan-1-one (PubChem CID 22216732) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[(1R,4R,12R,16S)-7,8,9-trimethoxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6,8,10-trien-5-yl]propan-1-one.
| Compound Name | 1-[(1R,4R,12R,16S)-7,8,9-trimethoxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6,8,10-trien-5-yl]propan-1-one |
|---|---|
| PubChem CID | 22216732 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-[(1R,4R,12R,16S)-7,8,9-trimethoxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6,8,10-trien-5-yl]propan-1-one |
| SMILES | CCC(=O)N1c2c(cc(OC)c(OC)c2OC)[C@@]23CCN4CCC[C@]5(CCO[C@@]452)CC[C@@H]13 |
| InChI | InChI=1S/C25H34N2O5/c1-5-19(28)27-18-7-9-23-8-6-12-26-13-10-24(18,25(23,26)32-14-11-23)16-15-17(29-2)21(30-3)22(31-4)20(16)27/h15,18H,5-14H2,1-4H3/t18-,23-,24-,25+/m1/s1 |
| InChIKey | GHVUBGHTWNPERR-BEDYVLDCSA-N |
| XLogP | 3.47 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |