About 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide
2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide (PubChem CID 22217190) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide |
| PubChem CID | 22217190 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide |
| SMILES | NC(=O)CC1=NCC(=O)N1 |
| InChI | InChI=1S/C5H7N3O2/c6-3(9)1-4-7-2-5(10)8-4/h1-2H2,(H2,6,9)(H,7,8,10) |
| InChIKey | KTSNEZSFFYQUHB-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide?
The IUPAC name of 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide (CID 22217190) is 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide.
What is the SMILES notation for 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide?
The canonical SMILES for 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide is NC(=O)CC1=NCC(=O)N1.
What is the InChIKey of 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide?
The InChIKey is KTSNEZSFFYQUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-3(9)1-4-7-2-5(10)8-4/h1-2H2,(H2,6,9)(H,7,8,10).
What are the key properties of 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide?
2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide has a molecular weight of 141.13 g/mol, XLogP of -1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,4-dihydroimidazol-2-yl)acetamide is sourced from PubChem (CID 22217190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).