C25H44O3Si2 — CID 22217193
(3S,8R,9S,10S,13S,14S)-13-methyl-3-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 22217193) has the molecular formula C25H44O3Si2 and a molecular weight of 448.80 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S)-13-methyl-3-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8R,9S,10S,13S,14S)-13-methyl-3-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22217193 |
| Molecular Formula | C25H44O3Si2 |
| Molecular Weight | 448.80 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S)-13-methyl-3-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O[Si](C)(C)C)CC[C@@]43CO[Si](C)(C)C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H44O3Si2/c1-24-14-13-22-20(21(24)10-11-23(24)26)9-8-18-16-19(28-30(5,6)7)12-15-25(18,22)17-27-29(2,3)4/h8,19-22H,9-17H2,1-7H3/t19-,20-,21-,22-,24-,25+/m0/s1 |
| InChIKey | NCZRIJGJRHTSTQ-SGEJCHJDSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.80 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|