C26H28N2O4 — CID 22217279
2-[2-[2-(N-ethylanilino)-2-oxoethoxy]phenoxy]-N-(2-ethylphenyl)acetamide (PubChem CID 22217279) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[2-[2-(N-ethylanilino)-2-oxoethoxy]phenoxy]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[2-[2-(N-ethylanilino)-2-oxoethoxy]phenoxy]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 22217279 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[2-[2-(N-ethylanilino)-2-oxoethoxy]phenoxy]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)COc1ccccc1OCC(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c1-3-20-12-8-9-15-22(20)27-25(29)18-31-23-16-10-11-17-24(23)32-19-26(30)28(4-2)21-13-6-5-7-14-21/h5-17H,3-4,18-19H2,1-2H3,(H,27,29) |
| InChIKey | KOFUHEKZVNEXSA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |