C23H30O5 — CID 22217297
[(8S,9S,10R,12S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3,11-dioxo-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate (PubChem CID 22217297) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(8S,9S,10R,12S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3,11-dioxo-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate.
| Compound Name | [(8S,9S,10R,12S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3,11-dioxo-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate |
|---|---|
| PubChem CID | 22217297 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(8S,9S,10R,12S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3,11-dioxo-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)[C@H]2[C@@H](CCC3=CC(=O)CC[C@@]32C)[C@@H]2CC[C@H](C(C)=O)[C@@]12C |
| InChI | InChI=1S/C23H30O5/c1-12(24)17-7-8-18-16-6-5-14-11-15(26)9-10-22(14,3)19(16)20(27)21(23(17,18)4)28-13(2)25/h11,16-19,21H,5-10H2,1-4H3/t16-,17+,18-,19+,21+,22-,23+/m0/s1 |
| InChIKey | POCMGIHPCDWXTB-TZEHSYAMSA-N |
| XLogP | 3.44 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|