About (6-cyanonaphthalen-2-yl) heptanoate
(6-cyanonaphthalen-2-yl) heptanoate (PubChem CID 22217405) has the molecular formula C18H19NO2
and a molecular weight of 281.36 g/mol. Its IUPAC name is (6-cyanonaphthalen-2-yl) heptanoate.
Molecular Properties
| Compound Name | (6-cyanonaphthalen-2-yl) heptanoate |
| PubChem CID | 22217405 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (6-cyanonaphthalen-2-yl) heptanoate |
| SMILES | CCCCCCC(=O)Oc1ccc2cc(C#N)ccc2c1 |
| InChI | InChI=1S/C18H19NO2/c1-2-3-4-5-6-18(20)21-17-10-9-15-11-14(13-19)7-8-16(15)12-17/h7-12H,2-6H2,1H3 |
| InChIKey | GMHUCCKAXOSGNS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-cyanonaphthalen-2-yl) heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyanonaphthalen-2-yl) heptanoate?
The IUPAC name of (6-cyanonaphthalen-2-yl) heptanoate (CID 22217405) is (6-cyanonaphthalen-2-yl) heptanoate.
What is the SMILES notation for (6-cyanonaphthalen-2-yl) heptanoate?
The canonical SMILES for (6-cyanonaphthalen-2-yl) heptanoate is CCCCCCC(=O)Oc1ccc2cc(C#N)ccc2c1.
What is the InChIKey of (6-cyanonaphthalen-2-yl) heptanoate?
The InChIKey is GMHUCCKAXOSGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c1-2-3-4-5-6-18(20)21-17-10-9-15-11-14(13-19)7-8-16(15)12-17/h7-12H,2-6H2,1H3.
What are the key properties of (6-cyanonaphthalen-2-yl) heptanoate?
(6-cyanonaphthalen-2-yl) heptanoate has a molecular weight of 281.36 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyanonaphthalen-2-yl) heptanoate is sourced from PubChem (CID 22217405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).