About 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one
7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one (PubChem CID 2221771) has the molecular formula C11H8F3NOS2
and a molecular weight of 291.32 g/mol. Its IUPAC name is 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
| PubChem CID | 2221771 |
| Molecular Formula | C11H8F3NOS2 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2c(C(F)(F)F)cccc2C12SCCS2 |
| InChI | InChI=1S/C11H8F3NOS2/c12-11(13,14)7-3-1-2-6-8(7)15-9(16)10(6)17-4-5-18-10/h1-3H,4-5H2,(H,15,16) |
| InChIKey | YTGWZPCQQXILFZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one?
The IUPAC name of 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one (CID 2221771) is 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one is O=C1Nc2c(C(F)(F)F)cccc2C12SCCS2.
What is the InChIKey of 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one?
The InChIKey is YTGWZPCQQXILFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3NOS2/c12-11(13,14)7-3-1-2-6-8(7)15-9(16)10(6)17-4-5-18-10/h1-3H,4-5H2,(H,15,16).
What are the key properties of 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one?
7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one has a molecular weight of 291.32 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-(trifluoromethyl)spiro[1,3-dithiolane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 2221771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).