C28H27N5O5 — CID 22217909
1-(2-methoxy-4-nitrophenyl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea (PubChem CID 22217909) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 22217909 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)Nc1ccc(-c2ccc(CN3CCOCC3)nc2)c2ccccc12 |
| InChI | InChI=1S/C28H27N5O5/c1-37-27-16-21(33(35)36)8-10-26(27)31-28(34)30-25-11-9-22(23-4-2-3-5-24(23)25)19-6-7-20(29-17-19)18-32-12-14-38-15-13-32/h2-11,16-17H,12-15,18H2,1H3,(H2,30,31,34) |
| InChIKey | BKVJLRPQHGWDNH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|