C30H33F5N4O3 — CID 22217921
1-[2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]naphthalen-1-yl]urea (PubChem CID 22217921) has the molecular formula C30H33F5N4O3 and a molecular weight of 592.61 g/mol. Its IUPAC name is 1-[2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]naphthalen-1-yl]urea.
| Compound Name | 1-[2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 22217921 |
| Molecular Formula | C30H33F5N4O3 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 1-[2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]naphthalen-1-yl]urea |
| SMILES | COc1ccc(C(F)(F)C(F)(F)F)cc1NC(=O)Nc1ccc(N2CCC(CN3CCOCC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C30H33F5N4O3/c1-41-27-9-6-21(29(31,32)30(33,34)35)18-25(27)37-28(40)36-24-7-8-26(23-5-3-2-4-22(23)24)39-12-10-20(11-13-39)19-38-14-16-42-17-15-38/h2-9,18,20H,10-17,19H2,1H3,(H2,36,37,40) |
| InChIKey | SDDFXDGQQJJYFY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|