C15H14F3NO2 — CID 22218142
8,8-dimethyl-4-(trifluoromethyl)-7,9-dihydro-6H-pyrano[3,2-g]quinolin-2-one (PubChem CID 22218142) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 8,8-dimethyl-4-(trifluoromethyl)-7,9-dihydro-6H-pyrano[3,2-g]quinolin-2-one.
| Compound Name | 8,8-dimethyl-4-(trifluoromethyl)-7,9-dihydro-6H-pyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 22218142 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 8,8-dimethyl-4-(trifluoromethyl)-7,9-dihydro-6H-pyrano[3,2-g]quinolin-2-one |
| SMILES | CC1(C)CCc2cc3c(C(F)(F)F)cc(=O)oc3cc2N1 |
| InChI | InChI=1S/C15H14F3NO2/c1-14(2)4-3-8-5-9-10(15(16,17)18)6-13(20)21-12(9)7-11(8)19-14/h5-7,19H,3-4H2,1-2H3 |
| InChIKey | XCAOBUOTWGIJFB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|