C6H8F4O4 — CID 22218151
ethyl 2,4,4,4-tetrafluoro-3,3-dihydroxybutanoate (PubChem CID 22218151) has the molecular formula C6H8F4O4 and a molecular weight of 220.12 g/mol. Its IUPAC name is ethyl 2,4,4,4-tetrafluoro-3,3-dihydroxybutanoate.
| Compound Name | ethyl 2,4,4,4-tetrafluoro-3,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 22218151 |
| Molecular Formula | C6H8F4O4 |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | ethyl 2,4,4,4-tetrafluoro-3,3-dihydroxybutanoate |
| SMILES | CCOC(=O)C(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H8F4O4/c1-2-14-4(11)3(7)5(12,13)6(8,9)10/h3,12-13H,2H2,1H3 |
| InChIKey | BITJDAQICIQMSQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|