C13H13F3N2O — CID 22218181
4-(trifluoromethyl)-3,5,5a,6,7,8-hexahydro-1H-pyrido[2,3-g]quinolin-2-one (PubChem CID 22218181) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 4-(trifluoromethyl)-3,5,5a,6,7,8-hexahydro-1H-pyrido[2,3-g]quinolin-2-one.
| Compound Name | 4-(trifluoromethyl)-3,5,5a,6,7,8-hexahydro-1H-pyrido[2,3-g]quinolin-2-one |
|---|---|
| PubChem CID | 22218181 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-(trifluoromethyl)-3,5,5a,6,7,8-hexahydro-1H-pyrido[2,3-g]quinolin-2-one |
| SMILES | O=C1CC(C(F)(F)F)=C2CC3NCCC=C3C=C2N1 |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)9-6-12(19)18-11-4-7-2-1-3-17-10(7)5-8(9)11/h2,4,10,17H,1,3,5-6H2,(H,18,19) |
| InChIKey | WOYTYVSCZMASFI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |