About 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol
6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol (PubChem CID 22218273) has the molecular formula C14H19BrO
and a molecular weight of 283.21 g/mol. Its IUPAC name is 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol |
| PubChem CID | 22218273 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol |
| SMILES | CCC1(O)CCC(C)(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H19BrO/c1-4-14(16)8-7-13(2,3)12-9-10(15)5-6-11(12)14/h5-6,9,16H,4,7-8H2,1-3H3 |
| InChIKey | FNNACGFYJQDXTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol?
The IUPAC name of 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol (CID 22218273) is 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol.
What is the SMILES notation for 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol?
The canonical SMILES for 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol is CCC1(O)CCC(C)(C)c2cc(Br)ccc21.
What is the InChIKey of 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol?
The InChIKey is FNNACGFYJQDXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrO/c1-4-14(16)8-7-13(2,3)12-9-10(15)5-6-11(12)14/h5-6,9,16H,4,7-8H2,1-3H3.
What are the key properties of 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol?
6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol has a molecular weight of 283.21 g/mol, XLogP of 4.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-ethyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ol is sourced from PubChem (CID 22218273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).