3,4,5,5-tetrafluoro-2-methylidenepentanoic acid

C6H6F4O2 — CID 22218680

IUPAC3,4,5,5-tetrafluoro-2-methylidenepentanoic acid
SMILESC=C(C(=O)O)C(F)C(F)C(F)F
InChIInChI=1S/C6H6F4O2/c1-2(6(11)12)3(7)4(8)5(9)10/h3-5H,1H2,(H,11,12)
InChIKeyQXXHQIHIKLDCNW-UHFFFAOYSA-N
MW186.10 g/mol
LogP1.57
Rot. Bonds4

About 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid

3,4,5,5-tetrafluoro-2-methylidenepentanoic acid (PubChem CID 22218680) has the molecular formula C6H6F4O2 and a molecular weight of 186.10 g/mol. Its IUPAC name is 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid.

Molecular Properties

Compound Name3,4,5,5-tetrafluoro-2-methylidenepentanoic acid
PubChem CID22218680
Molecular FormulaC6H6F4O2
Molecular Weight186.10 g/mol
Exact Mass186.03
IUPAC Name3,4,5,5-tetrafluoro-2-methylidenepentanoic acid
SMILESC=C(C(=O)O)C(F)C(F)C(F)F
InChIInChI=1S/C6H6F4O2/c1-2(6(11)12)3(7)4(8)5(9)10/h3-5H,1H2,(H,11,12)
InChIKeyQXXHQIHIKLDCNW-UHFFFAOYSA-N
XLogP1.57
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.10
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid?
The IUPAC name of 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid (CID 22218680) is 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid.
What is the SMILES notation for 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid?
The canonical SMILES for 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid is C=C(C(=O)O)C(F)C(F)C(F)F.
What is the InChIKey of 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid?
The InChIKey is QXXHQIHIKLDCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F4O2/c1-2(6(11)12)3(7)4(8)5(9)10/h3-5H,1H2,(H,11,12).
What are the key properties of 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid?
3,4,5,5-tetrafluoro-2-methylidenepentanoic acid has a molecular weight of 186.10 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,5-tetrafluoro-2-methylidenepentanoic acid is sourced from PubChem (CID 22218680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).