About 3,4-difluoropyridazine
3,4-difluoropyridazine (PubChem CID 22218742) has the molecular formula C4H2F2N2
and a molecular weight of 116.07 g/mol. Its IUPAC name is 3,4-difluoropyridazine.
Molecular Properties
| Compound Name | 3,4-difluoropyridazine |
| PubChem CID | 22218742 |
| Molecular Formula | C4H2F2N2 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.02 |
| IUPAC Name | 3,4-difluoropyridazine |
| SMILES | Fc1ccnnc1F |
| InChI | InChI=1S/C4H2F2N2/c5-3-1-2-7-8-4(3)6/h1-2H |
| InChIKey | BFUXVNFVPPCFIT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-difluoropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoropyridazine?
The IUPAC name of 3,4-difluoropyridazine (CID 22218742) is 3,4-difluoropyridazine.
What is the SMILES notation for 3,4-difluoropyridazine?
The canonical SMILES for 3,4-difluoropyridazine is Fc1ccnnc1F.
What is the InChIKey of 3,4-difluoropyridazine?
The InChIKey is BFUXVNFVPPCFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F2N2/c5-3-1-2-7-8-4(3)6/h1-2H.
What are the key properties of 3,4-difluoropyridazine?
3,4-difluoropyridazine has a molecular weight of 116.07 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoropyridazine is sourced from PubChem (CID 22218742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).