C9H12N2O3S2 — CID 22218826
6-(ethylsulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione (PubChem CID 22218826) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-(ethylsulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione.
| Compound Name | 6-(ethylsulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione |
|---|---|
| PubChem CID | 22218826 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 6-(ethylsulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione |
| SMILES | CCSCC1NC(=O)C2CSC(=O)N2C1=O |
| InChI | InChI=1S/C9H12N2O3S2/c1-2-15-3-5-8(13)11-6(7(12)10-5)4-16-9(11)14/h5-6H,2-4H2,1H3,(H,10,12) |
| InChIKey | WRBVPDCQODRVFX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|