About 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid
3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid (PubChem CID 2221901) has the molecular formula C19H16N2O5S
and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid |
| PubChem CID | 2221901 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2ccc(NC(=O)CSc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C19H16N2O5S/c22-16(11-27-13-4-2-1-3-5-13)20-12-6-7-14-15(10-12)19(26)21(18(14)25)9-8-17(23)24/h1-7,10H,8-9,11H2,(H,20,22)(H,23,24) |
| InChIKey | ULBOBBLKHXRABE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid?
The IUPAC name of 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid (CID 2221901) is 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid.
What is the SMILES notation for 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid?
The canonical SMILES for 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid is O=C(O)CCN1C(=O)c2ccc(NC(=O)CSc3ccccc3)cc2C1=O.
What is the InChIKey of 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid?
The InChIKey is ULBOBBLKHXRABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O5S/c22-16(11-27-13-4-2-1-3-5-13)20-12-6-7-14-15(10-12)19(26)21(18(14)25)9-8-17(23)24/h1-7,10H,8-9,11H2,(H,20,22)(H,23,24).
What are the key properties of 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid?
3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid has a molecular weight of 384.41 g/mol, XLogP of 2.49, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-dioxo-5-[(2-phenylsulfanylacetyl)amino]isoindol-2-yl]propanoic acid is sourced from PubChem (CID 2221901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).