About 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one
4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one (PubChem CID 22219238) has the molecular formula C14H25NO6
and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one |
| PubChem CID | 22219238 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one |
| SMILES | CC(C)CC1CC(=O)N(CC2(O)OC(CO)C(O)C2O)C1 |
| InChI | InChI=1S/C14H25NO6/c1-8(2)3-9-4-11(17)15(5-9)7-14(20)13(19)12(18)10(6-16)21-14/h8-10,12-13,16,18-20H,3-7H2,1-2H3 |
| InChIKey | BAZBIXRKAXNTCJ-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one?
The IUPAC name of 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one (CID 22219238) is 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one.
What is the SMILES notation for 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one?
The canonical SMILES for 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one is CC(C)CC1CC(=O)N(CC2(O)OC(CO)C(O)C2O)C1.
What is the InChIKey of 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one?
The InChIKey is BAZBIXRKAXNTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO6/c1-8(2)3-9-4-11(17)15(5-9)7-14(20)13(19)12(18)10(6-16)21-14/h8-10,12-13,16,18-20H,3-7H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one?
4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one has a molecular weight of 303.36 g/mol, XLogP of -1.32, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-1-[[2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]pyrrolidin-2-one is sourced from PubChem (CID 22219238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).