C13H11F6NO4S — CID 22219607
[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl] trifluoromethanesulfonate (PubChem CID 22219607) has the molecular formula C13H11F6NO4S and a molecular weight of 391.29 g/mol. Its IUPAC name is [3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22219607 |
| Molecular Formula | C13H11F6NO4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | [3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl] trifluoromethanesulfonate |
| SMILES | O=C(N1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1)C(F)(F)F |
| InChI | InChI=1S/C13H11F6NO4S/c14-12(15,16)11(21)20-6-4-8-2-1-3-10(9(8)5-7-20)24-25(22,23)13(17,18)19/h1-3H,4-7H2 |
| InChIKey | HIFYAZFGFVDKQQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|