(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate

C14H18F2N2O2 — CID 22219860

IUPAC(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
SMILESCC1CNCC(C)N1C(=O)OCc1c(F)cccc1F
InChIInChI=1S/C14H18F2N2O2/c1-9-6-17-7-10(2)18(9)14(19)20-8-11-12(15)4-3-5-13(11)16/h3-5,9-10,17H,6-8H2,1-2H3
InChIKeyUVQAAYCCKXIGIK-UHFFFAOYSA-N
MW284.31 g/mol
LogP2.28
Rot. Bonds2

About (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate

(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate (PubChem CID 22219860) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate.

Molecular Properties

Compound Name(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
PubChem CID22219860
Molecular FormulaC14H18F2N2O2
Molecular Weight284.31 g/mol
Exact Mass284.13
IUPAC Name(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
SMILESCC1CNCC(C)N1C(=O)OCc1c(F)cccc1F
InChIInChI=1S/C14H18F2N2O2/c1-9-6-17-7-10(2)18(9)14(19)20-8-11-12(15)4-3-5-13(11)16/h3-5,9-10,17H,6-8H2,1-2H3
InChIKeyUVQAAYCCKXIGIK-UHFFFAOYSA-N
XLogP2.28
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The IUPAC name of (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate (CID 22219860) is (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate.
What is the SMILES notation for (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The canonical SMILES for (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate is CC1CNCC(C)N1C(=O)OCc1c(F)cccc1F.
What is the InChIKey of (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The InChIKey is UVQAAYCCKXIGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N2O2/c1-9-6-17-7-10(2)18(9)14(19)20-8-11-12(15)4-3-5-13(11)16/h3-5,9-10,17H,6-8H2,1-2H3.
What are the key properties of (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
(2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate has a molecular weight of 284.31 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate is sourced from PubChem (CID 22219860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).