C12H21ClN2O3 — CID 22219933
tert-butyl 4-carbonochloridoyl-3,5-dimethylpiperazine-1-carboxylate (PubChem CID 22219933) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is tert-butyl 4-carbonochloridoyl-3,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-carbonochloridoyl-3,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 22219933 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | tert-butyl 4-carbonochloridoyl-3,5-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC(C)N1C(=O)Cl |
| InChI | InChI=1S/C12H21ClN2O3/c1-8-6-14(11(17)18-12(3,4)5)7-9(2)15(8)10(13)16/h8-9H,6-7H2,1-5H3 |
| InChIKey | XQYJANFHPUJZBR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|