C14H18F2N2O2 — CID 22219996
(2,5-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate (PubChem CID 22219996) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2,5-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | (2,5-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 22219996 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2,5-difluorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CNCC(C)N1C(=O)OCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H18F2N2O2/c1-9-6-17-7-10(2)18(9)14(19)20-8-11-5-12(15)3-4-13(11)16/h3-5,9-10,17H,6-8H2,1-2H3 |
| InChIKey | FAHIECZTEZSXIJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |