C21H15FN2O2S — CID 2222013
N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-3-fluorobenzamide (PubChem CID 2222013) has the molecular formula C21H15FN2O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-3-fluorobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 2222013 |
| Molecular Formula | C21H15FN2O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-3-fluorobenzamide |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H15FN2O2S/c1-26-18-10-9-14(21-24-16-7-2-3-8-19(16)27-21)12-17(18)23-20(25)13-5-4-6-15(22)11-13/h2-12H,1H3,(H,23,25) |
| InChIKey | IBEQIYBEGFYSKC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |