C21H21N3O5S2 — CID 22220503
4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[4-(4-oxopiperidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 22220503) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[4-(4-oxopiperidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[4-(4-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22220503 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[4-(4-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1CCN(c2ccc(NS(=O)(=O)c3ccc(CC4SC(=O)NC4=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H21N3O5S2/c25-17-9-11-24(12-10-17)16-5-3-15(4-6-16)23-31(28,29)18-7-1-14(2-8-18)13-19-20(26)22-21(27)30-19/h1-8,19,23H,9-13H2,(H,22,26,27) |
| InChIKey | GGRGDEXPPNAAGR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|