About 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide
4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide (PubChem CID 22220711) has the molecular formula C7H10BrNS
and a molecular weight of 220.13 g/mol. Its IUPAC name is 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide.
Molecular Properties
| Compound Name | 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide |
| PubChem CID | 22220711 |
| Molecular Formula | C7H10BrNS |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide |
| SMILES | C#CC[N+]1=CSCC1C.[Br-] |
| InChI | InChI=1S/C7H10NS.BrH/c1-3-4-8-6-9-5-7(8)2;/h1,6-7H,4-5H2,2H3;1H/q+1;/p-1 |
| InChIKey | IUBALRWYWJCAQX-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide?
The IUPAC name of 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide (CID 22220711) is 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide.
What is the SMILES notation for 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide?
The canonical SMILES for 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide is C#CC[N+]1=CSCC1C.[Br-].
What is the InChIKey of 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide?
The InChIKey is IUBALRWYWJCAQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10NS.BrH/c1-3-4-8-6-9-5-7(8)2;/h1,6-7H,4-5H2,2H3;1H/q+1;/p-1.
What are the key properties of 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide?
4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide has a molecular weight of 220.13 g/mol, XLogP of -2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide is sourced from PubChem (CID 22220711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).