C8H12BrNS — CID 22220718
4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide (PubChem CID 22220718) has the molecular formula C8H12BrNS and a molecular weight of 234.16 g/mol. Its IUPAC name is 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide.
| Compound Name | 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide |
|---|---|
| PubChem CID | 22220718 |
| Molecular Formula | C8H12BrNS |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium bromide |
| SMILES | C#CC[N+]1=CSC(C)C1C.[Br-] |
| InChI | InChI=1S/C8H12NS.BrH/c1-4-5-9-6-10-8(3)7(9)2;/h1,6-8H,5H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | WWUWPASTGMNPME-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|