2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid

C10H9NO3 — CID 22220877

IUPAC2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)C1COC(c2ccccc2)=N1
InChIInChI=1S/C10H9NO3/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,13)
InChIKeyQNPHKDLKBBKGQM-UHFFFAOYSA-N
MW191.19 g/mol
LogP0.92
Rot. Bonds2

About 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid

2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 22220877) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
PubChem CID22220877
Molecular FormulaC10H9NO3
Molecular Weight191.19 g/mol
Exact Mass191.06
IUPAC Name2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)C1COC(c2ccccc2)=N1
InChIInChI=1S/C10H9NO3/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,13)
InChIKeyQNPHKDLKBBKGQM-UHFFFAOYSA-N
XLogP0.92
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 50.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (CID 22220877) is 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is O=C(O)C1COC(c2ccccc2)=N1.
What is the InChIKey of 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The InChIKey is QNPHKDLKBBKGQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,13).
What are the key properties of 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid has a molecular weight of 191.19 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 22220877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).