About 6-bromo-2,3-dihydroisoindol-1-one
6-bromo-2,3-dihydroisoindol-1-one (PubChem CID 22220919) has the molecular formula C8H6BrNO
and a molecular weight of 212.05 g/mol. Its IUPAC name is 6-bromo-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-bromo-2,3-dihydroisoindol-1-one |
| PubChem CID | 22220919 |
| Molecular Formula | C8H6BrNO |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 210.96 |
| IUPAC Name | 6-bromo-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(Br)cc21 |
| InChI | InChI=1S/C8H6BrNO/c9-6-2-1-5-4-10-8(11)7(5)3-6/h1-3H,4H2,(H,10,11) |
| InChIKey | HYTCKZQYVIURAW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-bromo-2,3-dihydroisoindol-1-one (CID 22220919) is 6-bromo-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-bromo-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-bromo-2,3-dihydroisoindol-1-one is O=C1NCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2,3-dihydroisoindol-1-one?
The InChIKey is HYTCKZQYVIURAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO/c9-6-2-1-5-4-10-8(11)7(5)3-6/h1-3H,4H2,(H,10,11).
What are the key properties of 6-bromo-2,3-dihydroisoindol-1-one?
6-bromo-2,3-dihydroisoindol-1-one has a molecular weight of 212.05 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 22220919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).