About methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate
methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate (PubChem CID 22221152) has the molecular formula C13H11Cl2NO3
and a molecular weight of 300.14 g/mol. Its IUPAC name is methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate |
| PubChem CID | 22221152 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1conc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3/c1-18-12(17)5-3-9-7-19-16-13(9)8-2-4-10(14)11(15)6-8/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | KPJPPHFRSOYHPF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate?
The IUPAC name of methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate (CID 22221152) is methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate.
What is the SMILES notation for methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate?
The canonical SMILES for methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate is COC(=O)CCc1conc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate?
The InChIKey is KPJPPHFRSOYHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NO3/c1-18-12(17)5-3-9-7-19-16-13(9)8-2-4-10(14)11(15)6-8/h2,4,6-7H,3,5H2,1H3.
What are the key properties of methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate?
methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate has a molecular weight of 300.14 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]propanoate is sourced from PubChem (CID 22221152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).