C30H5BF20I- — CID 22222054
iodobenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 22222054) has the molecular formula C30H5BF20I- and a molecular weight of 883.05 g/mol. Its IUPAC name is iodobenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | iodobenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 22222054 |
| Molecular Formula | C30H5BF20I- |
| Molecular Weight | 883.05 g/mol |
| Exact Mass | 882.92 |
| IUPAC Name | iodobenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.Ic1ccccc1 |
| InChI | InChI=1S/C24BF20.C6H5I/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;7-6-4-2-1-3-5-6/h;1-5H/q-1; |
| InChIKey | AMXFPKXPUHAZTB-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.05 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|